About 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine
1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine (PubChem CID 106583654) has the molecular formula C16H19F2N3
and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine.
Molecular Properties
| Compound Name | 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine |
| PubChem CID | 106583654 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine |
| SMILES | Cc1cc(F)c(Nc2nccn2C2CCCCC2)cc1F |
| InChI | InChI=1S/C16H19F2N3/c1-11-9-14(18)15(10-13(11)17)20-16-19-7-8-21(16)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,19,20) |
| InChIKey | AVTLDGKVZXJQQL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine?
The IUPAC name of 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine (CID 106583654) is 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine.
What is the SMILES notation for 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine?
The canonical SMILES for 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine is Cc1cc(F)c(Nc2nccn2C2CCCCC2)cc1F.
What is the InChIKey of 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine?
The InChIKey is AVTLDGKVZXJQQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19F2N3/c1-11-9-14(18)15(10-13(11)17)20-16-19-7-8-21(16)12-5-3-2-4-6-12/h7-10,12H,2-6H2,1H3,(H,19,20).
What are the key properties of 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine?
1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine has a molecular weight of 291.35 g/mol, XLogP of 4.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-N-(2,5-difluoro-4-methylphenyl)imidazol-2-amine is sourced from PubChem (CID 106583654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).