C13H22N4 — CID 106559035
1-(1-azabicyclo[2.2.2]octan-3-yl)-N-propylimidazol-2-amine (PubChem CID 106559035) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1-(1-azabicyclo[2.2.2]octan-3-yl)-N-propylimidazol-2-amine.
| Compound Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-N-propylimidazol-2-amine |
|---|---|
| PubChem CID | 106559035 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1-(1-azabicyclo[2.2.2]octan-3-yl)-N-propylimidazol-2-amine |
| SMILES | CCCNc1nccn1C1CN2CCC1CC2 |
| InChI | InChI=1S/C13H22N4/c1-2-5-14-13-15-6-9-17(13)12-10-16-7-3-11(12)4-8-16/h6,9,11-12H,2-5,7-8,10H2,1H3,(H,14,15) |
| InChIKey | ZOWLIOPKNAXUNI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |