C14H23N3 — CID 106575467
1-(2-bicyclo[2.2.1]heptanyl)-N-butylimidazol-2-amine (PubChem CID 106575467) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-butylimidazol-2-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-butylimidazol-2-amine |
|---|---|
| PubChem CID | 106575467 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-butylimidazol-2-amine |
| SMILES | CCCCNc1nccn1C1CC2CCC1C2 |
| InChI | InChI=1S/C14H23N3/c1-2-3-6-15-14-16-7-8-17(14)13-10-11-4-5-12(13)9-11/h7-8,11-13H,2-6,9-10H2,1H3,(H,15,16) |
| InChIKey | PLGWFSFZVHNYKN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|