C14H25N3 — CID 106561726
N-butyl-1-(3-methylcyclohexyl)imidazol-2-amine (PubChem CID 106561726) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is N-butyl-1-(3-methylcyclohexyl)imidazol-2-amine.
| Compound Name | N-butyl-1-(3-methylcyclohexyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106561726 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | N-butyl-1-(3-methylcyclohexyl)imidazol-2-amine |
| SMILES | CCCCNc1nccn1C1CCCC(C)C1 |
| InChI | InChI=1S/C14H25N3/c1-3-4-8-15-14-16-9-10-17(14)13-7-5-6-12(2)11-13/h9-10,12-13H,3-8,11H2,1-2H3,(H,15,16) |
| InChIKey | QVNQBYQDNJIHSO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|