C12H18F3N3 — CID 106579149
1-cyclopentyl-N-(4,4,4-trifluorobutyl)imidazol-2-amine (PubChem CID 106579149) has the molecular formula C12H18F3N3 and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-cyclopentyl-N-(4,4,4-trifluorobutyl)imidazol-2-amine.
| Compound Name | 1-cyclopentyl-N-(4,4,4-trifluorobutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106579149 |
| Molecular Formula | C12H18F3N3 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-cyclopentyl-N-(4,4,4-trifluorobutyl)imidazol-2-amine |
| SMILES | FC(F)(F)CCCNc1nccn1C1CCCC1 |
| InChI | InChI=1S/C12H18F3N3/c13-12(14,15)6-3-7-16-11-17-8-9-18(11)10-4-1-2-5-10/h8-10H,1-7H2,(H,16,17) |
| InChIKey | LAYPDOGZQPNFIJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|