C13H15Cl2N3O — CID 106560326
1-(2,3-dichlorophenyl)-N-(3-methoxypropyl)imidazol-2-amine (PubChem CID 106560326) has the molecular formula C13H15Cl2N3O and a molecular weight of 300.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-N-(3-methoxypropyl)imidazol-2-amine.
| Compound Name | 1-(2,3-dichlorophenyl)-N-(3-methoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106560326 |
| Molecular Formula | C13H15Cl2N3O |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-N-(3-methoxypropyl)imidazol-2-amine |
| SMILES | COCCCNc1nccn1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl2N3O/c1-19-9-3-6-16-13-17-7-8-18(13)11-5-2-4-10(14)12(11)15/h2,4-5,7-8H,3,6,9H2,1H3,(H,16,17) |
| InChIKey | KDCBLYMWGNMEBR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|