C13H15BrClN3O — CID 106580686
1-(2-bromo-5-chloro-4-methylphenyl)-N-(2-methoxyethyl)imidazol-2-amine (PubChem CID 106580686) has the molecular formula C13H15BrClN3O and a molecular weight of 344.64 g/mol. Its IUPAC name is 1-(2-bromo-5-chloro-4-methylphenyl)-N-(2-methoxyethyl)imidazol-2-amine.
| Compound Name | 1-(2-bromo-5-chloro-4-methylphenyl)-N-(2-methoxyethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106580686 |
| Molecular Formula | C13H15BrClN3O |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 1-(2-bromo-5-chloro-4-methylphenyl)-N-(2-methoxyethyl)imidazol-2-amine |
| SMILES | COCCNc1nccn1-c1cc(Cl)c(C)cc1Br |
| InChI | InChI=1S/C13H15BrClN3O/c1-9-7-10(14)12(8-11(9)15)18-5-3-16-13(18)17-4-6-19-2/h3,5,7-8H,4,6H2,1-2H3,(H,16,17) |
| InChIKey | SUUCNFQFTQKRDE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|