C16H20FN3 — CID 106560946
N-cyclopentyl-1-[(3-fluorophenyl)methyl]-4-methylimidazol-2-amine (PubChem CID 106560946) has the molecular formula C16H20FN3 and a molecular weight of 273.35 g/mol. Its IUPAC name is N-cyclopentyl-1-[(3-fluorophenyl)methyl]-4-methylimidazol-2-amine.
| Compound Name | N-cyclopentyl-1-[(3-fluorophenyl)methyl]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106560946 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | N-cyclopentyl-1-[(3-fluorophenyl)methyl]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(Cc2cccc(F)c2)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H20FN3/c1-12-10-20(11-13-5-4-6-14(17)9-13)16(18-12)19-15-7-2-3-8-15/h4-6,9-10,15H,2-3,7-8,11H2,1H3,(H,18,19) |
| InChIKey | STSHRJJWCOYLIR-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |