C16H19ClFN3 — CID 106570212
1-[(3-chloro-4-fluorophenyl)methyl]-N-cyclopentyl-4-methylimidazol-2-amine (PubChem CID 106570212) has the molecular formula C16H19ClFN3 and a molecular weight of 307.80 g/mol. Its IUPAC name is 1-[(3-chloro-4-fluorophenyl)methyl]-N-cyclopentyl-4-methylimidazol-2-amine.
| Compound Name | 1-[(3-chloro-4-fluorophenyl)methyl]-N-cyclopentyl-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106570212 |
| Molecular Formula | C16H19ClFN3 |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[(3-chloro-4-fluorophenyl)methyl]-N-cyclopentyl-4-methylimidazol-2-amine |
| SMILES | Cc1cn(Cc2ccc(F)c(Cl)c2)c(NC2CCCC2)n1 |
| InChI | InChI=1S/C16H19ClFN3/c1-11-9-21(10-12-6-7-15(18)14(17)8-12)16(19-11)20-13-4-2-3-5-13/h6-9,13H,2-5,10H2,1H3,(H,19,20) |
| InChIKey | QFFSRSFLDFKEKV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |