C10H9F2N3O — CID 106561142
N-[4-(difluoromethoxy)phenyl]-1H-imidazol-2-amine (PubChem CID 106561142) has the molecular formula C10H9F2N3O and a molecular weight of 225.20 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-1H-imidazol-2-amine.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106561142 |
| Molecular Formula | C10H9F2N3O |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-1H-imidazol-2-amine |
| SMILES | FC(F)Oc1ccc(Nc2ncc[nH]2)cc1 |
| InChI | InChI=1S/C10H9F2N3O/c11-9(12)16-8-3-1-7(2-4-8)15-10-13-5-6-14-10/h1-6,9H,(H2,13,14,15) |
| InChIKey | SRZOZYZMKFXHEM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |