C10H12ClN3S — CID 106564555
1-[1-(5-chlorothiophen-2-yl)ethyl]-4-methylimidazol-2-amine (PubChem CID 106564555) has the molecular formula C10H12ClN3S and a molecular weight of 241.75 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)ethyl]-4-methylimidazol-2-amine.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106564555 |
| Molecular Formula | C10H12ClN3S |
| Molecular Weight | 241.75 g/mol |
| Exact Mass | 241.04 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)ethyl]-4-methylimidazol-2-amine |
| SMILES | Cc1cn(C(C)c2ccc(Cl)s2)c(N)n1 |
| InChI | InChI=1S/C10H12ClN3S/c1-6-5-14(10(12)13-6)7(2)8-3-4-9(11)15-8/h3-5,7H,1-2H3,(H2,12,13) |
| InChIKey | JCKBILFTEREMRH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.75 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |