C12H12ClN3OS — CID 99842071
(2R)-2-(5-chlorothiophen-2-yl)-N-(4-methylpyrimidin-2-yl)propanamide (PubChem CID 99842071) has the molecular formula C12H12ClN3OS and a molecular weight of 281.77 g/mol. Its IUPAC name is (2R)-2-(5-chlorothiophen-2-yl)-N-(4-methylpyrimidin-2-yl)propanamide.
| Compound Name | (2R)-2-(5-chlorothiophen-2-yl)-N-(4-methylpyrimidin-2-yl)propanamide |
|---|---|
| PubChem CID | 99842071 |
| Molecular Formula | C12H12ClN3OS |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (2R)-2-(5-chlorothiophen-2-yl)-N-(4-methylpyrimidin-2-yl)propanamide |
| SMILES | Cc1ccnc(NC(=O)[C@@H](C)c2ccc(Cl)s2)n1 |
| InChI | InChI=1S/C12H12ClN3OS/c1-7-5-6-14-12(15-7)16-11(17)8(2)9-3-4-10(13)18-9/h3-6,8H,1-2H3,(H,14,15,16,17)/t8-/m0/s1 |
| InChIKey | FDVMTOFSLUJMMG-QMMMGPOBSA-N |
| XLogP | 3.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |