C12H16ClNO3S — CID 97008635
methyl (2S)-2-[[(2S)-2-(5-chlorothiophen-2-yl)propanoyl]amino]butanoate (PubChem CID 97008635) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-(5-chlorothiophen-2-yl)propanoyl]amino]butanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-(5-chlorothiophen-2-yl)propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 97008635 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-(5-chlorothiophen-2-yl)propanoyl]amino]butanoate |
| SMILES | CC[C@H](NC(=O)[C@H](C)c1ccc(Cl)s1)C(=O)OC |
| InChI | InChI=1S/C12H16ClNO3S/c1-4-8(12(16)17-3)14-11(15)7(2)9-5-6-10(13)18-9/h5-8H,4H2,1-3H3,(H,14,15)/t7-,8+/m1/s1 |
| InChIKey | ZBQZMQCYPDOWLG-SFYZADRCSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |