C11H18Cl2N2O2S — CID 120989904
2-amino-N-[1-(5-chlorothiophen-2-yl)propyl]-3-methoxypropanamide;hydrochloride (PubChem CID 120989904) has the molecular formula C11H18Cl2N2O2S and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-amino-N-[1-(5-chlorothiophen-2-yl)propyl]-3-methoxypropanamide;hydrochloride.
| Compound Name | 2-amino-N-[1-(5-chlorothiophen-2-yl)propyl]-3-methoxypropanamide;hydrochloride |
|---|---|
| PubChem CID | 120989904 |
| Molecular Formula | C11H18Cl2N2O2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 2-amino-N-[1-(5-chlorothiophen-2-yl)propyl]-3-methoxypropanamide;hydrochloride |
| SMILES | CCC(NC(=O)C(N)COC)c1ccc(Cl)s1.Cl |
| InChI | InChI=1S/C11H17ClN2O2S.ClH/c1-3-8(9-4-5-10(12)17-9)14-11(15)7(13)6-16-2;/h4-5,7-8H,3,6,13H2,1-2H3,(H,14,15);1H |
| InChIKey | AJJLDLCSZASTCW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |