C13H16ClNO3S — CID 120535867
2-[2-(5-chlorothiophen-2-yl)propanoylamino]-3-cyclopropylpropanoic acid (PubChem CID 120535867) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)propanoylamino]-3-cyclopropylpropanoic acid.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)propanoylamino]-3-cyclopropylpropanoic acid |
|---|---|
| PubChem CID | 120535867 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)propanoylamino]-3-cyclopropylpropanoic acid |
| SMILES | CC(C(=O)NC(CC1CC1)C(=O)O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H16ClNO3S/c1-7(10-4-5-11(14)19-10)12(16)15-9(13(17)18)6-8-2-3-8/h4-5,7-9H,2-3,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | DJPMQTWNDLLPHL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |