C13H24N4O — CID 106566544
N-(3-ethoxypropyl)-1-(1-methylpyrrolidin-3-yl)imidazol-2-amine (PubChem CID 106566544) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-1-(1-methylpyrrolidin-3-yl)imidazol-2-amine.
| Compound Name | N-(3-ethoxypropyl)-1-(1-methylpyrrolidin-3-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106566544 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-(3-ethoxypropyl)-1-(1-methylpyrrolidin-3-yl)imidazol-2-amine |
| SMILES | CCOCCCNc1nccn1C1CCN(C)C1 |
| InChI | InChI=1S/C13H24N4O/c1-3-18-10-4-6-14-13-15-7-9-17(13)12-5-8-16(2)11-12/h7,9,12H,3-6,8,10-11H2,1-2H3,(H,14,15) |
| InChIKey | DNJFQOMNHANPOB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|