C15H27N3O2 — CID 106578750
1-(2,2-dimethyloxan-4-yl)-N-(3-ethoxypropyl)imidazol-2-amine (PubChem CID 106578750) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-(2,2-dimethyloxan-4-yl)-N-(3-ethoxypropyl)imidazol-2-amine.
| Compound Name | 1-(2,2-dimethyloxan-4-yl)-N-(3-ethoxypropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106578750 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 1-(2,2-dimethyloxan-4-yl)-N-(3-ethoxypropyl)imidazol-2-amine |
| SMILES | CCOCCCNc1nccn1C1CCOC(C)(C)C1 |
| InChI | InChI=1S/C15H27N3O2/c1-4-19-10-5-7-16-14-17-8-9-18(14)13-6-11-20-15(2,3)12-13/h8-9,13H,4-7,10-12H2,1-3H3,(H,16,17) |
| InChIKey | VNOFWVDYWONFMK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|