About 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine
3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 106567740) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine |
| PubChem CID | 106567740 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | COCCn1cc(C)nc1NC(C)CCN(C)C |
| InChI | InChI=1S/C13H26N4O/c1-11(6-7-16(3)4)14-13-15-12(2)10-17(13)8-9-18-5/h10-11H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | KRRMQMALQRNADC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine?
The IUPAC name of 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine (CID 106567740) is 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine.
What is the SMILES notation for 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine?
The canonical SMILES for 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine is COCCn1cc(C)nc1NC(C)CCN(C)C.
What is the InChIKey of 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine?
The InChIKey is KRRMQMALQRNADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O/c1-11(6-7-16(3)4)14-13-15-12(2)10-17(13)8-9-18-5/h10-11H,6-9H2,1-5H3,(H,14,15).
What are the key properties of 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine?
3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine has a molecular weight of 254.38 g/mol, XLogP of 1.59, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-[1-(2-methoxyethyl)-4-methylimidazol-2-yl]-1-N,1-N-dimethylbutane-1,3-diamine is sourced from PubChem (CID 106567740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).