C12H23N3O2S — CID 106581065
N-(1-methoxypropan-2-yl)-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine (PubChem CID 106581065) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106581065 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine |
| SMILES | COCC(C)Nc1nc(C)cn1CC(C)S(C)=O |
| InChI | InChI=1S/C12H23N3O2S/c1-9-6-15(7-11(3)18(5)16)12(13-9)14-10(2)8-17-4/h6,10-11H,7-8H2,1-5H3,(H,13,14) |
| InChIKey | PAXSKCFIBZDJJD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |