C10H19N3OS — CID 106581055
N-ethyl-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine (PubChem CID 106581055) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is N-ethyl-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine.
| Compound Name | N-ethyl-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106581055 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | N-ethyl-4-methyl-1-(2-methylsulfinylpropyl)imidazol-2-amine |
| SMILES | CCNc1nc(C)cn1CC(C)S(C)=O |
| InChI | InChI=1S/C10H19N3OS/c1-5-11-10-12-8(2)6-13(10)7-9(3)15(4)14/h6,9H,5,7H2,1-4H3,(H,11,12) |
| InChIKey | DXQNWUZOEFBLEG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |