C9H17N3OS — CID 106581380
N-ethyl-4-methyl-1-(2-methylsulfinylethyl)imidazol-2-amine (PubChem CID 106581380) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is N-ethyl-4-methyl-1-(2-methylsulfinylethyl)imidazol-2-amine.
| Compound Name | N-ethyl-4-methyl-1-(2-methylsulfinylethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106581380 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-ethyl-4-methyl-1-(2-methylsulfinylethyl)imidazol-2-amine |
| SMILES | CCNc1nc(C)cn1CCS(C)=O |
| InChI | InChI=1S/C9H17N3OS/c1-4-10-9-11-8(2)7-12(9)5-6-14(3)13/h7H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | VZWCHPMBCLRHBE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |