C13H26OSi — CID 10656884
(3R,4R)-2-methyl-4-propan-2-yl-6-trimethylsilylhex-5-yn-3-ol (PubChem CID 10656884) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is (3R,4R)-2-methyl-4-propan-2-yl-6-trimethylsilylhex-5-yn-3-ol.
| Compound Name | (3R,4R)-2-methyl-4-propan-2-yl-6-trimethylsilylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 10656884 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (3R,4R)-2-methyl-4-propan-2-yl-6-trimethylsilylhex-5-yn-3-ol |
| SMILES | CC(C)[C@@H](O)[C@@H](C#C[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C13H26OSi/c1-10(2)12(13(14)11(3)4)8-9-15(5,6)7/h10-14H,1-7H3/t12-,13+/m0/s1 |
| InChIKey | YIDDXNVTWCOSKY-QWHCGFSZSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|