C12H17N5 — CID 106569292
N-(2-imidazol-1-ylethyl)-4-methyl-1-prop-2-enylimidazol-2-amine (PubChem CID 106569292) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is N-(2-imidazol-1-ylethyl)-4-methyl-1-prop-2-enylimidazol-2-amine.
| Compound Name | N-(2-imidazol-1-ylethyl)-4-methyl-1-prop-2-enylimidazol-2-amine |
|---|---|
| PubChem CID | 106569292 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-(2-imidazol-1-ylethyl)-4-methyl-1-prop-2-enylimidazol-2-amine |
| SMILES | C=CCn1cc(C)nc1NCCn1ccnc1 |
| InChI | InChI=1S/C12H17N5/c1-3-6-17-9-11(2)15-12(17)14-5-8-16-7-4-13-10-16/h3-4,7,9-10H,1,5-6,8H2,2H3,(H,14,15) |
| InChIKey | HPGXWPKRRLXJIG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|