C11H15N5 — CID 106568790
4-methyl-1-prop-2-enyl-N-(1H-pyrazol-4-ylmethyl)imidazol-2-amine (PubChem CID 106568790) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 4-methyl-1-prop-2-enyl-N-(1H-pyrazol-4-ylmethyl)imidazol-2-amine.
| Compound Name | 4-methyl-1-prop-2-enyl-N-(1H-pyrazol-4-ylmethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106568790 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 4-methyl-1-prop-2-enyl-N-(1H-pyrazol-4-ylmethyl)imidazol-2-amine |
| SMILES | C=CCn1cc(C)nc1NCc1cn[nH]c1 |
| InChI | InChI=1S/C11H15N5/c1-3-4-16-8-9(2)15-11(16)12-5-10-6-13-14-7-10/h3,6-8H,1,4-5H2,2H3,(H,12,15)(H,13,14) |
| InChIKey | VGIOIBSFBNGION-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|