C14H17ClFN3O — CID 106570194
N-[(3-chloro-4-fluorophenyl)methyl]-1-(1-methoxypropan-2-yl)imidazol-2-amine (PubChem CID 106570194) has the molecular formula C14H17ClFN3O and a molecular weight of 297.76 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-1-(1-methoxypropan-2-yl)imidazol-2-amine.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-(1-methoxypropan-2-yl)imidazol-2-amine |
|---|---|
| PubChem CID | 106570194 |
| Molecular Formula | C14H17ClFN3O |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-1-(1-methoxypropan-2-yl)imidazol-2-amine |
| SMILES | COCC(C)n1ccnc1NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClFN3O/c1-10(9-20-2)19-6-5-17-14(19)18-8-11-3-4-13(16)12(15)7-11/h3-7,10H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | OMJBPDVRHAEAON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |