C15H16F3N3 — CID 106570813
N-cyclohexyl-1-(3,4,5-trifluorophenyl)imidazol-2-amine (PubChem CID 106570813) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is N-cyclohexyl-1-(3,4,5-trifluorophenyl)imidazol-2-amine.
| Compound Name | N-cyclohexyl-1-(3,4,5-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106570813 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-cyclohexyl-1-(3,4,5-trifluorophenyl)imidazol-2-amine |
| SMILES | Fc1cc(-n2ccnc2NC2CCCCC2)cc(F)c1F |
| InChI | InChI=1S/C15H16F3N3/c16-12-8-11(9-13(17)14(12)18)21-7-6-19-15(21)20-10-4-2-1-3-5-10/h6-10H,1-5H2,(H,19,20) |
| InChIKey | KSSWGGFNOPXYHV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|