C12H14F3N — CID 62810275
N-cyclohexyl-3,4,5-trifluoroaniline (PubChem CID 62810275) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is N-cyclohexyl-3,4,5-trifluoroaniline.
| Compound Name | N-cyclohexyl-3,4,5-trifluoroaniline |
|---|---|
| PubChem CID | 62810275 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-cyclohexyl-3,4,5-trifluoroaniline |
| SMILES | Fc1cc(NC2CCCCC2)cc(F)c1F |
| InChI | InChI=1S/C12H14F3N/c13-10-6-9(7-11(14)12(10)15)16-8-4-2-1-3-5-8/h6-8,16H,1-5H2 |
| InChIKey | GRGGMWKAWCYPTL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|