C10H8F3N3 — CID 106570934
N-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine (PubChem CID 106570934) has the molecular formula C10H8F3N3 and a molecular weight of 227.19 g/mol. Its IUPAC name is N-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine.
| Compound Name | N-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106570934 |
| Molecular Formula | C10H8F3N3 |
| Molecular Weight | 227.19 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-methyl-1-(2,3,5-trifluorophenyl)imidazol-2-amine |
| SMILES | CNc1nccn1-c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C10H8F3N3/c1-14-10-15-2-3-16(10)8-5-6(11)4-7(12)9(8)13/h2-5H,1H3,(H,14,15) |
| InChIKey | ILUSIXDVXKSJGI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.19 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|