C11H18F3N3 — CID 106571611
1-butyl-4-methyl-N-(3,3,3-trifluoropropyl)imidazol-2-amine (PubChem CID 106571611) has the molecular formula C11H18F3N3 and a molecular weight of 249.28 g/mol. Its IUPAC name is 1-butyl-4-methyl-N-(3,3,3-trifluoropropyl)imidazol-2-amine.
| Compound Name | 1-butyl-4-methyl-N-(3,3,3-trifluoropropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106571611 |
| Molecular Formula | C11H18F3N3 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-butyl-4-methyl-N-(3,3,3-trifluoropropyl)imidazol-2-amine |
| SMILES | CCCCn1cc(C)nc1NCCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3/c1-3-4-7-17-8-9(2)16-10(17)15-6-5-11(12,13)14/h8H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | VECRUEMTAFWFMD-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |