C12H20F3N3 — CID 106579279
4-methyl-N-propyl-1-(5,5,5-trifluoropentyl)imidazol-2-amine (PubChem CID 106579279) has the molecular formula C12H20F3N3 and a molecular weight of 263.31 g/mol. Its IUPAC name is 4-methyl-N-propyl-1-(5,5,5-trifluoropentyl)imidazol-2-amine.
| Compound Name | 4-methyl-N-propyl-1-(5,5,5-trifluoropentyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106579279 |
| Molecular Formula | C12H20F3N3 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-methyl-N-propyl-1-(5,5,5-trifluoropentyl)imidazol-2-amine |
| SMILES | CCCNc1nc(C)cn1CCCCC(F)(F)F |
| InChI | InChI=1S/C12H20F3N3/c1-3-7-16-11-17-10(2)9-18(11)8-5-4-6-12(13,14)15/h9H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | OAHVOZUJKPUEFY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|