C11H21N3 — CID 106573791
1-hexyl-N,4-dimethylimidazol-2-amine (PubChem CID 106573791) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-hexyl-N,4-dimethylimidazol-2-amine.
| Compound Name | 1-hexyl-N,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 106573791 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-hexyl-N,4-dimethylimidazol-2-amine |
| SMILES | CCCCCCn1cc(C)nc1NC |
| InChI | InChI=1S/C11H21N3/c1-4-5-6-7-8-14-9-10(2)13-11(14)12-3/h9H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | UHVSICDNNRMJGG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|