C10H19N3S — CID 106579956
N,4-dimethyl-1-(4-methylsulfanylbutyl)imidazol-2-amine (PubChem CID 106579956) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is N,4-dimethyl-1-(4-methylsulfanylbutyl)imidazol-2-amine.
| Compound Name | N,4-dimethyl-1-(4-methylsulfanylbutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106579956 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | N,4-dimethyl-1-(4-methylsulfanylbutyl)imidazol-2-amine |
| SMILES | CNc1nc(C)cn1CCCCSC |
| InChI | InChI=1S/C10H19N3S/c1-9-8-13(10(11-2)12-9)6-4-5-7-14-3/h8H,4-7H2,1-3H3,(H,11,12) |
| InChIKey | KRHBMVHAMBOVFI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|