C9H17N3S — CID 106573659
1,4-dimethyl-N-(3-methylsulfanylpropyl)imidazol-2-amine (PubChem CID 106573659) has the molecular formula C9H17N3S and a molecular weight of 199.32 g/mol. Its IUPAC name is 1,4-dimethyl-N-(3-methylsulfanylpropyl)imidazol-2-amine.
| Compound Name | 1,4-dimethyl-N-(3-methylsulfanylpropyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106573659 |
| Molecular Formula | C9H17N3S |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 1,4-dimethyl-N-(3-methylsulfanylpropyl)imidazol-2-amine |
| SMILES | CSCCCNc1nc(C)cn1C |
| InChI | InChI=1S/C9H17N3S/c1-8-7-12(2)9(11-8)10-5-4-6-13-3/h7H,4-6H2,1-3H3,(H,10,11) |
| InChIKey | WYEQOLKZGVBNIW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|