C15H21N3O2 — CID 106555784
1-[2-(3,4-dimethoxyphenyl)ethyl]-N,4-dimethylimidazol-2-amine (PubChem CID 106555784) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-N,4-dimethylimidazol-2-amine.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-N,4-dimethylimidazol-2-amine |
|---|---|
| PubChem CID | 106555784 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-N,4-dimethylimidazol-2-amine |
| SMILES | CNc1nc(C)cn1CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-11-10-18(15(16-2)17-11)8-7-12-5-6-13(19-3)14(9-12)20-4/h5-6,9-10H,7-8H2,1-4H3,(H,16,17) |
| InChIKey | MORYOWOUTVPZJF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |