C14H15N3O2 — CID 167905632
1-[2-(3,4-dimethoxyphenyl)ethyl]imidazole-2-carbonitrile (PubChem CID 167905632) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]imidazole-2-carbonitrile.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]imidazole-2-carbonitrile |
|---|---|
| PubChem CID | 167905632 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]imidazole-2-carbonitrile |
| SMILES | COc1ccc(CCn2ccnc2C#N)cc1OC |
| InChI | InChI=1S/C14H15N3O2/c1-18-12-4-3-11(9-13(12)19-2)5-7-17-8-6-16-14(17)10-15/h3-4,6,8-9H,5,7H2,1-2H3 |
| InChIKey | QWPIATPIZIEKJU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |