C12H20F3N3O2 — CID 106573349
1-(1-methoxypropan-2-yl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine (PubChem CID 106573349) has the molecular formula C12H20F3N3O2 and a molecular weight of 295.31 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine.
| Compound Name | 1-(1-methoxypropan-2-yl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106573349 |
| Molecular Formula | C12H20F3N3O2 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine |
| SMILES | COCC(C)n1cc(C)nc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C12H20F3N3O2/c1-9-6-18(10(2)7-19-3)11(17-9)16-4-5-20-8-12(13,14)15/h6,10H,4-5,7-8H2,1-3H3,(H,16,17) |
| InChIKey | ZGWWXYQCMIRQJP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|