C11H18F3N3O2 — CID 106573359
1-(2-methoxyethyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine (PubChem CID 106573359) has the molecular formula C11H18F3N3O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine.
| Compound Name | 1-(2-methoxyethyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106573359 |
| Molecular Formula | C11H18F3N3O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(2-methoxyethyl)-4-methyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-amine |
| SMILES | COCCn1cc(C)nc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H18F3N3O2/c1-9-7-17(4-6-18-2)10(16-9)15-3-5-19-8-11(12,13)14/h7H,3-6,8H2,1-2H3,(H,15,16) |
| InChIKey | RGSPZCKYNCFBGK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|