C15H17N5 — CID 106573444
4-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-phenylimidazol-2-amine (PubChem CID 106573444) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-phenylimidazol-2-amine.
| Compound Name | 4-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-phenylimidazol-2-amine |
|---|---|
| PubChem CID | 106573444 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-methyl-N-[(1-methylimidazol-2-yl)methyl]-1-phenylimidazol-2-amine |
| SMILES | Cc1cn(-c2ccccc2)c(NCc2nccn2C)n1 |
| InChI | InChI=1S/C15H17N5/c1-12-11-20(13-6-4-3-5-7-13)15(18-12)17-10-14-16-8-9-19(14)2/h3-9,11H,10H2,1-2H3,(H,17,18) |
| InChIKey | HJORUWAMJJCPRF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |