C13H14BrF2N3 — CID 106574076
N-(4-bromo-2,6-difluorophenyl)-1-butylimidazol-2-amine (PubChem CID 106574076) has the molecular formula C13H14BrF2N3 and a molecular weight of 330.18 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-1-butylimidazol-2-amine.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-1-butylimidazol-2-amine |
|---|---|
| PubChem CID | 106574076 |
| Molecular Formula | C13H14BrF2N3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-1-butylimidazol-2-amine |
| SMILES | CCCCn1ccnc1Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H14BrF2N3/c1-2-3-5-19-6-4-17-13(19)18-12-10(15)7-9(14)8-11(12)16/h4,6-8H,2-3,5H2,1H3,(H,17,18) |
| InChIKey | NLDSYKAJPBAYIA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |