C14H17Br2N3O — CID 106583543
1-butyl-N-(2,4-dibromo-5-methoxyphenyl)imidazol-2-amine (PubChem CID 106583543) has the molecular formula C14H17Br2N3O and a molecular weight of 403.12 g/mol. Its IUPAC name is 1-butyl-N-(2,4-dibromo-5-methoxyphenyl)imidazol-2-amine.
| Compound Name | 1-butyl-N-(2,4-dibromo-5-methoxyphenyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106583543 |
| Molecular Formula | C14H17Br2N3O |
| Molecular Weight | 403.12 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 1-butyl-N-(2,4-dibromo-5-methoxyphenyl)imidazol-2-amine |
| SMILES | CCCCn1ccnc1Nc1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C14H17Br2N3O/c1-3-4-6-19-7-5-17-14(19)18-12-9-13(20-2)11(16)8-10(12)15/h5,7-9H,3-4,6H2,1-2H3,(H,17,18) |
| InChIKey | FPWFFZLXDRCQEJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.12 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |