C16H19Cl2N3 — CID 106574142
1-cyclohexyl-N-(2,6-dichlorophenyl)-4-methylimidazol-2-amine (PubChem CID 106574142) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.25 g/mol. Its IUPAC name is 1-cyclohexyl-N-(2,6-dichlorophenyl)-4-methylimidazol-2-amine.
| Compound Name | 1-cyclohexyl-N-(2,6-dichlorophenyl)-4-methylimidazol-2-amine |
|---|---|
| PubChem CID | 106574142 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-cyclohexyl-N-(2,6-dichlorophenyl)-4-methylimidazol-2-amine |
| SMILES | Cc1cn(C2CCCCC2)c(Nc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C16H19Cl2N3/c1-11-10-21(12-6-3-2-4-7-12)16(19-11)20-15-13(17)8-5-9-14(15)18/h5,8-10,12H,2-4,6-7H2,1H3,(H,19,20) |
| InChIKey | LSWPRFGAIHAOHT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |