C11H19N3 — CID 106574900
N-(3-ethylcyclohexyl)-1H-imidazol-2-amine (PubChem CID 106574900) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(3-ethylcyclohexyl)-1H-imidazol-2-amine.
| Compound Name | N-(3-ethylcyclohexyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106574900 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-(3-ethylcyclohexyl)-1H-imidazol-2-amine |
| SMILES | CCC1CCCC(Nc2ncc[nH]2)C1 |
| InChI | InChI=1S/C11H19N3/c1-2-9-4-3-5-10(8-9)14-11-12-6-7-13-11/h6-7,9-10H,2-5,8H2,1H3,(H2,12,13,14) |
| InChIKey | ZUGHMDUALYGHKR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |