C15H22N4O — CID 106575849
N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-2-methylpyridin-3-amine (PubChem CID 106575849) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-2-methylpyridin-3-amine.
| Compound Name | N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-2-methylpyridin-3-amine |
|---|---|
| PubChem CID | 106575849 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-[1-(3-ethoxypropyl)-4-methylimidazol-2-yl]-2-methylpyridin-3-amine |
| SMILES | CCOCCCn1cc(C)nc1Nc1cccnc1C |
| InChI | InChI=1S/C15H22N4O/c1-4-20-10-6-9-19-11-12(2)17-15(19)18-14-7-5-8-16-13(14)3/h5,7-8,11H,4,6,9-10H2,1-3H3,(H,17,18) |
| InChIKey | AVRUCQBJQHABKT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|