C14H26N4O2 — CID 106576057
N-(1-methoxypropan-2-yl)-4-methyl-1-[(4-methylmorpholin-2-yl)methyl]imidazol-2-amine (PubChem CID 106576057) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-4-methyl-1-[(4-methylmorpholin-2-yl)methyl]imidazol-2-amine.
| Compound Name | N-(1-methoxypropan-2-yl)-4-methyl-1-[(4-methylmorpholin-2-yl)methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 106576057 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-4-methyl-1-[(4-methylmorpholin-2-yl)methyl]imidazol-2-amine |
| SMILES | COCC(C)Nc1nc(C)cn1CC1CN(C)CCO1 |
| InChI | InChI=1S/C14H26N4O2/c1-11-7-18(9-13-8-17(3)5-6-20-13)14(15-11)16-12(2)10-19-4/h7,12-13H,5-6,8-10H2,1-4H3,(H,15,16) |
| InChIKey | JLWIUJRJEJSFRO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |