C11H14BrN3OS — CID 106577759
1-[(3-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)imidazol-2-amine (PubChem CID 106577759) has the molecular formula C11H14BrN3OS and a molecular weight of 316.22 g/mol. Its IUPAC name is 1-[(3-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)imidazol-2-amine.
| Compound Name | 1-[(3-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106577759 |
| Molecular Formula | C11H14BrN3OS |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 1-[(3-bromothiophen-2-yl)methyl]-N-(2-methoxyethyl)imidazol-2-amine |
| SMILES | COCCNc1nccn1Cc1sccc1Br |
| InChI | InChI=1S/C11H14BrN3OS/c1-16-6-4-14-11-13-3-5-15(11)8-10-9(12)2-7-17-10/h2-3,5,7H,4,6,8H2,1H3,(H,13,14) |
| InChIKey | ITFSACPFHJQIRC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|