C13H26O2Si — CID 10657823
tert-butyl-[(2S)-2-[(2R,3S)-3-ethenyloxiran-2-yl]propoxy]-dimethylsilane (PubChem CID 10657823) has the molecular formula C13H26O2Si and a molecular weight of 242.43 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-[(2R,3S)-3-ethenyloxiran-2-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2S)-2-[(2R,3S)-3-ethenyloxiran-2-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10657823 |
| Molecular Formula | C13H26O2Si |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | tert-butyl-[(2S)-2-[(2R,3S)-3-ethenyloxiran-2-yl]propoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1O[C@@H]1[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O2Si/c1-8-11-12(15-11)10(2)9-14-16(6,7)13(3,4)5/h8,10-12H,1,9H2,2-7H3/t10-,11-,12+/m0/s1 |
| InChIKey | KRWKFXNQUXHESA-SDDRHHMPSA-N |
| XLogP | 3.60 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|