C16H19N5 — CID 106579501
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-phenylimidazol-2-amine (PubChem CID 106579501) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-phenylimidazol-2-amine.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-phenylimidazol-2-amine |
|---|---|
| PubChem CID | 106579501 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-1-phenylimidazol-2-amine |
| SMILES | CCc1nn(C)cc1CNc1nccn1-c1ccccc1 |
| InChI | InChI=1S/C16H19N5/c1-3-15-13(12-20(2)19-15)11-18-16-17-9-10-21(16)14-7-5-4-6-8-14/h4-10,12H,3,11H2,1-2H3,(H,17,18) |
| InChIKey | FCXJJTTWHIKZJY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |