C16H13F2N3 — CID 106573221
N-[(2,5-difluorophenyl)methyl]-1-phenylimidazol-2-amine (PubChem CID 106573221) has the molecular formula C16H13F2N3 and a molecular weight of 285.30 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-1-phenylimidazol-2-amine.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-1-phenylimidazol-2-amine |
|---|---|
| PubChem CID | 106573221 |
| Molecular Formula | C16H13F2N3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-1-phenylimidazol-2-amine |
| SMILES | Fc1ccc(F)c(CNc2nccn2-c2ccccc2)c1 |
| InChI | InChI=1S/C16H13F2N3/c17-13-6-7-15(18)12(10-13)11-20-16-19-8-9-21(16)14-4-2-1-3-5-14/h1-10H,11H2,(H,19,20) |
| InChIKey | UAERQQFFJJQXOU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |