C12H21N3O — CID 106580375
1-(1-methoxypropan-2-yl)-N-(1-methylcyclobutyl)imidazol-2-amine (PubChem CID 106580375) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(1-methoxypropan-2-yl)-N-(1-methylcyclobutyl)imidazol-2-amine.
| Compound Name | 1-(1-methoxypropan-2-yl)-N-(1-methylcyclobutyl)imidazol-2-amine |
|---|---|
| PubChem CID | 106580375 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-(1-methoxypropan-2-yl)-N-(1-methylcyclobutyl)imidazol-2-amine |
| SMILES | COCC(C)n1ccnc1NC1(C)CCC1 |
| InChI | InChI=1S/C12H21N3O/c1-10(9-16-3)15-8-7-13-11(15)14-12(2)5-4-6-12/h7-8,10H,4-6,9H2,1-3H3,(H,13,14) |
| InChIKey | SHGDIDKWOHZKSW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |