C10H9Cl2N3 — CID 106580607
N-(2,5-dichloro-4-methylphenyl)-1H-imidazol-2-amine (PubChem CID 106580607) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)-1H-imidazol-2-amine.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 106580607 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)-1H-imidazol-2-amine |
| SMILES | Cc1cc(Cl)c(Nc2ncc[nH]2)cc1Cl |
| InChI | InChI=1S/C10H9Cl2N3/c1-6-4-8(12)9(5-7(6)11)15-10-13-2-3-14-10/h2-5H,1H3,(H2,13,14,15) |
| InChIKey | VAZXCPJAUCNSGK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |